C16H21FN6O8 — CID 56967103
dimethyl (2S)-2-[[1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]pentanedioate (PubChem CID 56967103) has the molecular formula C16H21FN6O8 and a molecular weight of 444.38 g/mol. Its IUPAC name is dimethyl (2S)-2-[[1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[[1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]pentanedioate |
|---|---|
| PubChem CID | 56967103 |
| Molecular Formula | C16H21FN6O8 |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | dimethyl (2S)-2-[[1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]pentanedioate |
| SMILES | COC(=O)CC[C@H](Nc1ccn([C@@H]2O[C@@](CO)(N=[N+]=[N-])[C@@H](O)[C@@H]2F)c(=O)n1)C(=O)OC |
| InChI | InChI=1S/C16H21FN6O8/c1-29-10(25)4-3-8(14(27)30-2)19-9-5-6-23(15(28)20-9)13-11(17)12(26)16(7-24,31-13)21-22-18/h5-6,8,11-13,24,26H,3-4,7H2,1-2H3,(H,19,20,28)/t8-,11-,12-,13+,16+/m0/s1 |
| InChIKey | LFRRHJQMWXYGSU-GKHQVXQTSA-N |
| XLogP | -0.62 |
| TPSA | 197.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|