C11H14N6O6 — CID 71101442
[(2R,3S,4S)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methyl acetate (PubChem CID 71101442) has the molecular formula C11H14N6O6 and a molecular weight of 326.27 g/mol. Its IUPAC name is [(2R,3S,4S)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71101442 |
| Molecular Formula | C11H14N6O6 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | [(2R,3S,4S)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(N=[N+]=[N-])OC(n2ccc(N)nc2=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H14N6O6/c1-5(18)22-4-11(15-16-13)8(20)7(19)9(23-11)17-3-2-6(12)14-10(17)21/h2-3,7-9,19-20H,4H2,1H3,(H2,12,14,21)/t7-,8-,9?,11+/m0/s1 |
| InChIKey | PZULCSSSIQZCHY-OLHFHDQRSA-N |
| XLogP | -1.35 |
| TPSA | 185.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|