C17H26N7O9P — CID 91415720
[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-N-(1-ethoxycarbonylcyclopentyl)phosphonamidic acid (PubChem CID 91415720) has the molecular formula C17H26N7O9P and a molecular weight of 503.41 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-N-(1-ethoxycarbonylcyclopentyl)phosphonamidic acid.
| Compound Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-N-(1-ethoxycarbonylcyclopentyl)phosphonamidic acid |
|---|---|
| PubChem CID | 91415720 |
| Molecular Formula | C17H26N7O9P |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-N-(1-ethoxycarbonylcyclopentyl)phosphonamidic acid |
| SMILES | CCOC(=O)C1(NP(=O)(O)OC[C@@]2(N=[N+]=[N-])O[C@@H](n3ccc(N)nc3=O)[C@H](O)[C@@H]2O)CCCC1 |
| InChI | InChI=1S/C17H26N7O9P/c1-2-31-14(27)16(6-3-4-7-16)22-34(29,30)32-9-17(21-23-19)12(26)11(25)13(33-17)24-8-5-10(18)20-15(24)28/h5,8,11-13,25-26H,2-4,6-7,9H2,1H3,(H2,18,20,28)(H2,22,29,30)/t11-,12+,13-,17-/m1/s1 |
| InChIKey | DVPZRGKXJKQWOQ-IPJQOSJUSA-N |
| XLogP | -0.33 |
| TPSA | 244.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|