C9H15N6O13P3S — CID 174003605
[[(3R,4S,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 174003605) has the molecular formula C9H15N6O13P3S and a molecular weight of 540.24 g/mol. Its IUPAC name is [[(3R,4S,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(3R,4S,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174003605 |
| Molecular Formula | C9H15N6O13P3S |
| Molecular Weight | 540.24 g/mol |
| Exact Mass | 539.96 |
| IUPAC Name | [[(3R,4S,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [N-]=[N+]=NC1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](n2ccc(N)nc2=S)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H15N6O13P3S/c10-4-1-2-15(8(32)12-4)7-5(16)6(17)9(26-7,13-14-11)3-25-30(21,22)28-31(23,24)27-29(18,19)20/h1-2,5-7,16-17H,3H2,(H,21,22)(H,23,24)(H2,10,12,32)(H2,18,19,20)/t5-,6+,7+,9?/m0/s1 |
| InChIKey | HIHCRZOUSOVNLY-VAMDACQBSA-N |
| XLogP | -0.20 |
| TPSA | 302.11 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.24 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|