C9H15N3O10P2S — CID 154111650
[(2R,3S,4R,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 154111650) has the molecular formula C9H15N3O10P2S and a molecular weight of 419.25 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 154111650 |
| Molecular Formula | C9H15N3O10P2S |
| Molecular Weight | 419.25 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-amino-2-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=S)n1 |
| InChI | InChI=1S/C9H15N3O10P2S/c10-5-1-2-12(9(25)11-5)8-7(14)6(13)4(21-8)3-20-24(18,19)22-23(15,16)17/h1-2,4,6-8,13-14H,3H2,(H,18,19)(H2,10,11,25)(H2,15,16,17)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | RWYWYETWCOKLKR-XVFCMESISA-N |
| XLogP | -0.96 |
| TPSA | 206.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.25 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|