C9H13FN5O14P3S — CID 174003592
[[(3R,4S,5R)-2-azido-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 174003592) has the molecular formula C9H13FN5O14P3S and a molecular weight of 559.21 g/mol. Its IUPAC name is [[(3R,4S,5R)-2-azido-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(3R,4S,5R)-2-azido-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174003592 |
| Molecular Formula | C9H13FN5O14P3S |
| Molecular Weight | 559.21 g/mol |
| Exact Mass | 558.94 |
| IUPAC Name | [[(3R,4S,5R)-2-azido-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [N-]=[N+]=NC1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](n2cc(F)c(=O)[nH]c2=S)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H13FN5O14P3S/c10-3-1-15(8(33)12-6(3)18)7-4(16)5(17)9(27-7,13-14-11)2-26-31(22,23)29-32(24,25)28-30(19,20)21/h1,4-5,7,16-17H,2H2,(H,22,23)(H,24,25)(H,12,18,33)(H2,19,20,21)/t4-,5+,7+,9?/m0/s1 |
| InChIKey | VASLKQXOXXXEHQ-JVLZHZOFSA-N |
| XLogP | -0.35 |
| TPSA | 296.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.21 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|