C8H11FN5O14P3S — CID 153435883
[(2S,3R,5R)-2-azido-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 153435883) has the molecular formula C8H11FN5O14P3S and a molecular weight of 545.18 g/mol. Its IUPAC name is [(2S,3R,5R)-2-azido-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | [(2S,3R,5R)-2-azido-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 153435883 |
| Molecular Formula | C8H11FN5O14P3S |
| Molecular Weight | 545.18 g/mol |
| Exact Mass | 544.92 |
| IUPAC Name | [(2S,3R,5R)-2-azido-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | [N-]=[N+]=N[C@]1(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](n2cc(F)c(=O)[nH]c2=S)C(O)[C@H]1O |
| InChI | InChI=1S/C8H11FN5O14P3S/c9-2-1-14(7(32)11-5(2)17)6-3(15)4(16)8(25-6,12-13-10)26-30(21,22)28-31(23,24)27-29(18,19)20/h1,3-4,6,15-16H,(H,21,22)(H,23,24)(H,11,17,32)(H2,18,19,20)/t3?,4-,6-,8+/m1/s1 |
| InChIKey | RCDQWRPCXNXSKN-BFLTUREYSA-N |
| XLogP | -0.40 |
| TPSA | 296.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.18 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|