C8H11FN5O13P3S — CID 153435868
[(2S,3S,5R)-2-azido-4-fluoro-3-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 153435868) has the molecular formula C8H11FN5O13P3S and a molecular weight of 529.19 g/mol. Its IUPAC name is [(2S,3S,5R)-2-azido-4-fluoro-3-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | [(2S,3S,5R)-2-azido-4-fluoro-3-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 153435868 |
| Molecular Formula | C8H11FN5O13P3S |
| Molecular Weight | 529.19 g/mol |
| Exact Mass | 528.93 |
| IUPAC Name | [(2S,3S,5R)-2-azido-4-fluoro-3-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | [N-]=[N+]=N[C@]1(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](n2ccc(=S)[nH]c2=O)C(F)[C@H]1O |
| InChI | InChI=1S/C8H11FN5O13P3S/c9-4-5(15)8(12-13-10,24-6(4)14-2-1-3(31)11-7(14)16)25-29(20,21)27-30(22,23)26-28(17,18)19/h1-2,4-6,15H,(H,20,21)(H,22,23)(H,11,16,31)(H2,17,18,19)/t4?,5-,6-,8+/m1/s1 |
| InChIKey | VJVBRPMDVBJQDN-KJSJWNQGSA-N |
| XLogP | 0.44 |
| TPSA | 275.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|