C10H16FN4O14P3 — CID 126723894
[[(2R,3R,4R,5R)-2-(diazenylmethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 126723894) has the molecular formula C10H16FN4O14P3 and a molecular weight of 528.17 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-2-(diazenylmethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-2-(diazenylmethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 126723894 |
| Molecular Formula | C10H16FN4O14P3 |
| Molecular Weight | 528.17 g/mol |
| Exact Mass | 527.99 |
| IUPAC Name | [[(2R,3R,4R,5R)-2-(diazenylmethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [H]/N=N/C[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C10H16FN4O14P3/c11-6-7(17)10(3-13-12,27-8(6)15-2-1-5(16)14-9(15)18)4-26-31(22,23)29-32(24,25)28-30(19,20)21/h1-2,6-8,12,17H,3-4H2,(H,22,23)(H,24,25)(H,14,16,18)(H2,19,20,21)/b13-12+/t6-,7+,8-,10-/m1/s1 |
| InChIKey | QPNLKVFCVGRAKJ-PUNHDDJGSA-N |
| XLogP | -1.12 |
| TPSA | 280.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.17 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|