C10H15ClFN2O15P3 — CID 118595245
[[(2R,3R,4S,5R)-2-(chloromethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 118595245) has the molecular formula C10H15ClFN2O15P3 and a molecular weight of 550.60 g/mol. Its IUPAC name is [[(2R,3R,4S,5R)-2-(chloromethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4S,5R)-2-(chloromethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118595245 |
| Molecular Formula | C10H15ClFN2O15P3 |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 549.94 |
| IUPAC Name | [[(2R,3R,4S,5R)-2-(chloromethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@](CCl)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@]2(O)F)c(=O)[nH]1 |
| InChI | InChI=1S/C10H15ClFN2O15P3/c11-3-9(4-26-31(22,23)29-32(24,25)28-30(19,20)21)6(16)10(12,18)7(27-9)14-2-1-5(15)13-8(14)17/h1-2,6-7,16,18H,3-4H2,(H,22,23)(H,24,25)(H,13,15,17)(H2,19,20,21)/t6-,7-,9-,10-/m1/s1 |
| InChIKey | FDOYSZDHJDFZON-KHUVANEUSA-N |
| XLogP | -1.59 |
| TPSA | 264.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|