C11H15ClF2N2O10P2 — CID 123669357
[[2-(chloromethyl)-5-(2,4-dioxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-methylphosphinic acid (PubChem CID 123669357) has the molecular formula C11H15ClF2N2O10P2 and a molecular weight of 470.64 g/mol. Its IUPAC name is [[2-(chloromethyl)-5-(2,4-dioxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-methylphosphinic acid.
| Compound Name | [[2-(chloromethyl)-5-(2,4-dioxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 123669357 |
| Molecular Formula | C11H15ClF2N2O10P2 |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 469.99 |
| IUPAC Name | [[2-(chloromethyl)-5-(2,4-dioxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-methylphosphinic acid |
| SMILES | CP(=O)(O)OP(=O)(O)OCC1(CCl)OC(n2ccc(=O)[nH]c2=O)C(F)(F)C1O |
| InChI | InChI=1S/C11H15ClF2N2O10P2/c1-27(20,21)26-28(22,23)24-5-10(4-12)7(18)11(13,14)8(25-10)16-3-2-6(17)15-9(16)19/h2-3,7-8,18H,4-5H2,1H3,(H,20,21)(H,22,23)(H,15,17,19) |
| InChIKey | ORENXGWJTMDKST-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 177.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|