C11H18ClN2O14P3 — CID 126759269
[[(2R,3R,4R,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 126759269) has the molecular formula C11H18ClN2O14P3 and a molecular weight of 530.64 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 126759269 |
| Molecular Formula | C11H18ClN2O14P3 |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 529.97 |
| IUPAC Name | [[(2R,3R,4R,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](Cl)[C@@H]1O |
| InChI | InChI=1S/C11H18ClN2O14P3/c1-2-11(5-25-30(21,22)28-31(23,24)27-29(18,19)20)8(16)7(12)9(26-11)14-4-3-6(15)13-10(14)17/h3-4,7-9,16H,2,5H2,1H3,(H,21,22)(H,23,24)(H,13,15,17)(H2,18,19,20)/t7-,8+,9-,11-/m1/s1 |
| InChIKey | KHHICTOWBYZHAP-PKIKSRDPSA-N |
| XLogP | -0.47 |
| TPSA | 244.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|