C11H17FN2O11P2 — CID 123155673
[5-(2,4-dioxopyrimidin-1-yl)-2-ethoxy-4-fluorooxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 123155673) has the molecular formula C11H17FN2O11P2 and a molecular weight of 434.21 g/mol. Its IUPAC name is [5-(2,4-dioxopyrimidin-1-yl)-2-ethoxy-4-fluorooxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [5-(2,4-dioxopyrimidin-1-yl)-2-ethoxy-4-fluorooxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 123155673 |
| Molecular Formula | C11H17FN2O11P2 |
| Molecular Weight | 434.21 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | [5-(2,4-dioxopyrimidin-1-yl)-2-ethoxy-4-fluorooxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | CCOC1(COP(=O)(O)OP(=O)(O)O)CC(F)C(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C11H17FN2O11P2/c1-2-22-11(6-23-27(20,21)25-26(17,18)19)5-7(12)9(24-11)14-4-3-8(15)13-10(14)16/h3-4,7,9H,2,5-6H2,1H3,(H,20,21)(H,13,15,16)(H2,17,18,19) |
| InChIKey | ITZOYZCIASKOOJ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 186.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.21 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|