C10H13F2N2O15P3 — CID 90125303
[[(1R,3R,4R,7S)-3-(2,4-dioxopyrimidin-1-yl)-6,6-difluoro-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90125303) has the molecular formula C10H13F2N2O15P3 and a molecular weight of 532.13 g/mol. Its IUPAC name is [[(1R,3R,4R,7S)-3-(2,4-dioxopyrimidin-1-yl)-6,6-difluoro-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1R,3R,4R,7S)-3-(2,4-dioxopyrimidin-1-yl)-6,6-difluoro-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90125303 |
| Molecular Formula | C10H13F2N2O15P3 |
| Molecular Weight | 532.13 g/mol |
| Exact Mass | 531.95 |
| IUPAC Name | [[(1R,3R,4R,7S)-3-(2,4-dioxopyrimidin-1-yl)-6,6-difluoro-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@]3(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2OC3(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C10H13F2N2O15P3/c11-10(12)9(3-25-31(21,22)29-32(23,24)28-30(18,19)20)6(16)5(26-10)7(27-9)14-2-1-4(15)13-8(14)17/h1-2,5-7,16H,3H2,(H,21,22)(H,23,24)(H,13,15,17)(H2,18,19,20)/t5-,6+,7-,9-/m1/s1 |
| InChIKey | KBCCKMCPCUTPRQ-JVZYCSMKSA-N |
| XLogP | -1.50 |
| TPSA | 253.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.13 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|