C11H16FN2O14P3 — CID 155070087
[(1R,3R,4R,5R)-3-(2,4-dioxopyrimidin-1-yl)-1-ethyl-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 155070087) has the molecular formula C11H16FN2O14P3 and a molecular weight of 512.17 g/mol. Its IUPAC name is [(1R,3R,4R,5R)-3-(2,4-dioxopyrimidin-1-yl)-1-ethyl-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | [(1R,3R,4R,5R)-3-(2,4-dioxopyrimidin-1-yl)-1-ethyl-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 155070087 |
| Molecular Formula | C11H16FN2O14P3 |
| Molecular Weight | 512.17 g/mol |
| Exact Mass | 511.98 |
| IUPAC Name | [(1R,3R,4R,5R)-3-(2,4-dioxopyrimidin-1-yl)-1-ethyl-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | CC[C@]12O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](F)[C@@]1(O)C2OP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C11H16FN2O14P3/c1-2-10-8(26-30(21,22)28-31(23,24)27-29(18,19)20)11(10,17)6(12)7(25-10)14-4-3-5(15)13-9(14)16/h3-4,6-8,17H,2H2,1H3,(H,21,22)(H,23,24)(H,13,15,16)(H2,18,19,20)/t6-,7+,8?,10+,11+/m0/s1 |
| InChIKey | LNDKAJQWZZKJDC-UOGXANBQSA-N |
| XLogP | -0.99 |
| TPSA | 244.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.17 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|