C11H17F2N2O15P3 — CID 118016691
[[(2R,3S,4R,5R)-2-(difluoromethyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 118016691) has the molecular formula C11H17F2N2O15P3 and a molecular weight of 548.17 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-2-(difluoromethyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-2-(difluoromethyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118016691 |
| Molecular Formula | C11H17F2N2O15P3 |
| Molecular Weight | 548.17 g/mol |
| Exact Mass | 547.98 |
| IUPAC Name | [[(2R,3S,4R,5R)-2-(difluoromethyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@]1(O)[C@H](n2ccc(=O)[nH]c2=O)O[C@@](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)(C(F)F)[C@H]1O |
| InChI | InChI=1S/C11H17F2N2O15P3/c1-10(19)6(17)11(7(12)13,28-8(10)15-3-2-5(16)14-9(15)18)4-27-32(23,24)30-33(25,26)29-31(20,21)22/h2-3,6-8,17,19H,4H2,1H3,(H,23,24)(H,25,26)(H,14,16,18)(H2,20,21,22)/t6-,8+,10+,11+/m0/s1 |
| InChIKey | VYBJWOOSZAKLER-WBOFEENNSA-N |
| XLogP | -1.48 |
| TPSA | 264.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.17 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|