C12H18FN2O15P3 — CID 129152216
[[(2R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethenyl-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 129152216) has the molecular formula C12H18FN2O15P3 and a molecular weight of 542.20 g/mol. Its IUPAC name is [[(2R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethenyl-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethenyl-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 129152216 |
| Molecular Formula | C12H18FN2O15P3 |
| Molecular Weight | 542.20 g/mol |
| Exact Mass | 541.99 |
| IUPAC Name | [[(2R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethenyl-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=C[C@@]1(O)C(O)[C@@](CF)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H18FN2O15P3/c1-2-12(19)8(17)11(5-13,28-9(12)15-4-3-7(16)14-10(15)18)6-27-32(23,24)30-33(25,26)29-31(20,21)22/h2-4,8-9,17,19H,1,5-6H2,(H,23,24)(H,25,26)(H,14,16,18)(H2,20,21,22)/t8?,9-,11-,12-/m1/s1 |
| InChIKey | BDRVTGVHIXBAAM-WADXITAESA-N |
| XLogP | -1.61 |
| TPSA | 264.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.20 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|