C13H19ClFN2O14P3 — CID 123412473
[[2-(chloromethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-ethenyl-4-fluoro-3-methoxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 123412473) has the molecular formula C13H19ClFN2O14P3 and a molecular weight of 574.67 g/mol. Its IUPAC name is [[2-(chloromethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-ethenyl-4-fluoro-3-methoxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[2-(chloromethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-ethenyl-4-fluoro-3-methoxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 123412473 |
| Molecular Formula | C13H19ClFN2O14P3 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 573.97 |
| IUPAC Name | [[2-(chloromethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-ethenyl-4-fluoro-3-methoxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=CC1(F)C(n2ccc(=O)[nH]c2=O)OC(CCl)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1OC |
| InChI | InChI=1S/C13H19ClFN2O14P3/c1-3-13(15)9(27-2)12(6-14,29-10(13)17-5-4-8(18)16-11(17)19)7-28-33(23,24)31-34(25,26)30-32(20,21)22/h3-5,9-10H,1,6-7H2,2H3,(H,23,24)(H,25,26)(H,16,18,19)(H2,20,21,22) |
| InChIKey | BXSYBVAPENCYMW-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 233.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|