C11H19N2O13P3 — CID 144948869
[[(2S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,3-dimethyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 144948869) has the molecular formula C11H19N2O13P3 and a molecular weight of 480.20 g/mol. Its IUPAC name is [[(2S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,3-dimethyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,3-dimethyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 144948869 |
| Molecular Formula | C11H19N2O13P3 |
| Molecular Weight | 480.20 g/mol |
| Exact Mass | 480.01 |
| IUPAC Name | [[(2S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,3-dimethyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC1(C)C[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C11H19N2O13P3/c1-11(2)5-9(13-4-3-8(14)12-10(13)15)24-7(11)6-23-28(19,20)26-29(21,22)25-27(16,17)18/h3-4,7,9H,5-6H2,1-2H3,(H,19,20)(H,21,22)(H,12,14,15)(H2,16,17,18)/t7-,9-/m1/s1 |
| InChIKey | FGWLYZMHXQXRBI-VXNVDRBHSA-N |
| XLogP | 0.19 |
| TPSA | 223.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.20 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|