C10H17N2O13P3S — CID 123936728
[[5-(2,4-dioxopyrimidin-1-yl)-2-methoxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate (PubChem CID 123936728) has the molecular formula C10H17N2O13P3S and a molecular weight of 498.24 g/mol. Its IUPAC name is [[5-(2,4-dioxopyrimidin-1-yl)-2-methoxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate.
| Compound Name | [[5-(2,4-dioxopyrimidin-1-yl)-2-methoxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 123936728 |
| Molecular Formula | C10H17N2O13P3S |
| Molecular Weight | 498.24 g/mol |
| Exact Mass | 497.97 |
| IUPAC Name | [[5-(2,4-dioxopyrimidin-1-yl)-2-methoxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate |
| SMILES | COC1(COP(O)(=S)OP(=O)(O)OP(=O)(O)O)CCC(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C10H17N2O13P3S/c1-21-10(4-2-8(23-10)12-5-3-7(13)11-9(12)14)6-22-28(20,29)25-27(18,19)24-26(15,16)17/h3,5,8H,2,4,6H2,1H3,(H,18,19)(H,20,29)(H,11,13,14)(H2,15,16,17) |
| InChIKey | HGIGWXYGFNNTCN-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 216.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|