C11H15N2O13P3S — CID 118612374
[[(2S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate (PubChem CID 118612374) has the molecular formula C11H15N2O13P3S and a molecular weight of 508.23 g/mol. Its IUPAC name is [[(2S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118612374 |
| Molecular Formula | C11H15N2O13P3S |
| Molecular Weight | 508.23 g/mol |
| Exact Mass | 507.95 |
| IUPAC Name | [[(2S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate |
| SMILES | C#C[C@@]1(O)C[C@@H](COP(O)(=S)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15N2O13P3S/c1-2-11(16)5-7(24-9(11)13-4-3-8(14)12-10(13)15)6-23-29(22,30)26-28(20,21)25-27(17,18)19/h1,3-4,7,9,16H,5-6H2,(H,20,21)(H,22,30)(H,12,14,15)(H2,17,18,19)/t7-,9+,11+,29?/m0/s1 |
| InChIKey | QHBLVAJSFNFADG-DBCBPBASSA-N |
| XLogP | -1.35 |
| TPSA | 227.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.23 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|