C10H16N5O15P3 — CID 134603319
[[(2R,3S,5R)-4-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-2-methoxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 134603319) has the molecular formula C10H16N5O15P3 and a molecular weight of 539.18 g/mol. Its IUPAC name is [[(2R,3S,5R)-4-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-2-methoxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-4-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-2-methoxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 134603319 |
| Molecular Formula | C10H16N5O15P3 |
| Molecular Weight | 539.18 g/mol |
| Exact Mass | 538.99 |
| IUPAC Name | [[(2R,3S,5R)-4-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-2-methoxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CO[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](n2ccc(=O)[nH]c2=O)C(N=[N+]=[N-])[C@@H]1O |
| InChI | InChI=1S/C10H16N5O15P3/c1-26-10(4-27-32(22,23)30-33(24,25)29-31(19,20)21)7(17)6(13-14-11)8(28-10)15-3-2-5(16)12-9(15)18/h2-3,6-8,17H,4H2,1H3,(H,22,23)(H,24,25)(H,12,16,18)(H2,19,20,21)/t6?,7-,8+,10+/m0/s1 |
| InChIKey | COGCXHCJDOPFSS-NQHCQLFLSA-N |
| XLogP | -1.21 |
| TPSA | 302.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.18 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|