C10H14N5O9P — CID 118191443
[(2S,3S,4R,5R)-3-azido-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-methoxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 118191443) has the molecular formula C10H14N5O9P and a molecular weight of 379.22 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-3-azido-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-methoxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,3S,4R,5R)-3-azido-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-methoxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 118191443 |
| Molecular Formula | C10H14N5O9P |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | [(2S,3S,4R,5R)-3-azido-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-methoxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CO[C@]1(COP(=O)(O)O)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C10H14N5O9P/c1-22-10(4-23-25(19,20)21)7(13-14-11)6(17)8(24-10)15-3-2-5(16)12-9(15)18/h2-3,6-8,17H,4H2,1H3,(H,12,16,18)(H2,19,20,21)/t6-,7+,8-,10-/m1/s1 |
| InChIKey | NECBRBIFCBFVMC-IBCQBUCCSA-N |
| XLogP | -1.44 |
| TPSA | 209.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|