C10H13N5O6 — CID 22677620
1-[4-azido-3-hydroxy-5,5-bis(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 22677620) has the molecular formula C10H13N5O6 and a molecular weight of 299.24 g/mol. Its IUPAC name is 1-[4-azido-3-hydroxy-5,5-bis(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[4-azido-3-hydroxy-5,5-bis(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22677620 |
| Molecular Formula | C10H13N5O6 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-[4-azido-3-hydroxy-5,5-bis(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [N-]=[N+]=NC1C(O)C(n2ccc(=O)[nH]c2=O)OC1(CO)CO |
| InChI | InChI=1S/C10H13N5O6/c11-14-13-7-6(19)8(21-10(7,3-16)4-17)15-2-1-5(18)12-9(15)20/h1-2,6-8,16-17,19H,3-4H2,(H,12,18,20) |
| InChIKey | HGWGKGNPSSCCMU-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 173.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|