C10H13ClN2O6 — CID 175627372
1-[(2R,5R)-5-(chloromethyl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 175627372) has the molecular formula C10H13ClN2O6 and a molecular weight of 292.68 g/mol. Its IUPAC name is 1-[(2R,5R)-5-(chloromethyl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-5-(chloromethyl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175627372 |
| Molecular Formula | C10H13ClN2O6 |
| Molecular Weight | 292.68 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 1-[(2R,5R)-5-(chloromethyl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@@](CO)(CCl)C(O)C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H13ClN2O6/c11-3-10(4-14)7(17)6(16)8(19-10)13-2-1-5(15)12-9(13)18/h1-2,6-8,14,16-17H,3-4H2,(H,12,15,18)/t6?,7?,8-,10-/m1/s1 |
| InChIKey | MUKDSUQMBWIDDT-CJXRSZHYSA-N |
| XLogP | -2.24 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.68 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|