C11H14N2O6 — CID 118981429
1-[(2S,5S)-5-ethenyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 118981429) has the molecular formula C11H14N2O6 and a molecular weight of 270.24 g/mol. Its IUPAC name is 1-[(2S,5S)-5-ethenyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,5S)-5-ethenyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118981429 |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1-[(2S,5S)-5-ethenyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=C[C@@]1(CO)O[C@H](n2ccc(=O)[nH]c2=O)C(O)C1O |
| InChI | InChI=1S/C11H14N2O6/c1-2-11(5-14)8(17)7(16)9(19-11)13-4-3-6(15)12-10(13)18/h2-4,7-9,14,16-17H,1,5H2,(H,12,15,18)/t7?,8?,9-,11-/m0/s1 |
| InChIKey | PWIFWRFGPRGJAD-CAUGXEKISA-N |
| XLogP | -2.30 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|