C11H12N2O6 — CID 59968627
1-[(2R,5R)-5-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 59968627) has the molecular formula C11H12N2O6 and a molecular weight of 268.22 g/mol. Its IUPAC name is 1-[(2R,5R)-5-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-5-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59968627 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1-[(2R,5R)-5-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C#C[C@]1(CO)O[C@@H](n2ccc(=O)[nH]c2=O)C(O)C1O |
| InChI | InChI=1S/C11H12N2O6/c1-2-11(5-14)8(17)7(16)9(19-11)13-4-3-6(15)12-10(13)18/h1,3-4,7-9,14,16-17H,5H2,(H,12,15,18)/t7?,8?,9-,11-/m1/s1 |
| InChIKey | WRJWRPFBIXAXCQ-RSWAIMACSA-N |
| XLogP | -2.85 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|