C13H13ClN2O5 — CID 173108394
1-[(2R,3R,4S,5R)-3-(2-chloroethenyl)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 173108394) has the molecular formula C13H13ClN2O5 and a molecular weight of 312.71 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3-(2-chloroethenyl)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3-(2-chloroethenyl)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 173108394 |
| Molecular Formula | C13H13ClN2O5 |
| Molecular Weight | 312.71 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3-(2-chloroethenyl)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C#C[C@]1(CO)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](C=CCl)[C@@H]1O |
| InChI | InChI=1S/C13H13ClN2O5/c1-2-13(7-17)10(19)8(3-5-14)11(21-13)16-6-4-9(18)15-12(16)20/h1,3-6,8,10-11,17,19H,7H2,(H,15,18,20)/t8-,10+,11-,13-/m1/s1 |
| InChIKey | PLUPREGHEBTIBU-IHXVIFPJSA-N |
| XLogP | -0.84 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.71 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|