C11H15N8O8P — CID 137282428
[(2R,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-azido-3-hydroxy-2-methoxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 137282428) has the molecular formula C11H15N8O8P and a molecular weight of 418.26 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-azido-3-hydroxy-2-methoxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-azido-3-hydroxy-2-methoxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 137282428 |
| Molecular Formula | C11H15N8O8P |
| Molecular Weight | 418.26 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-azido-3-hydroxy-2-methoxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CO[C@]1(COP(=O)(O)O)O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@@H](N=[N+]=[N-])[C@@H]1O |
| InChI | InChI=1S/C11H15N8O8P/c1-25-11(2-26-28(22,23)24)6(20)4(17-18-13)9(27-11)19-3-14-5-7(19)15-10(12)16-8(5)21/h3-4,6,9,20H,2H2,1H3,(H2,22,23,24)(H3,12,15,16,21)/t4-,6-,9+,11+/m0/s1 |
| InChIKey | ATWQOJXJGRUCJV-RYNVUYHKSA-N |
| XLogP | -1.28 |
| TPSA | 243.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.26 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|