C10H11FN8O3 — CID 175676719
2-amino-9-[(2S,3S,4S,5R)-3-azido-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 175676719) has the molecular formula C10H11FN8O3 and a molecular weight of 310.25 g/mol. Its IUPAC name is 2-amino-9-[(2S,3S,4S,5R)-3-azido-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2S,3S,4S,5R)-3-azido-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 175676719 |
| Molecular Formula | C10H11FN8O3 |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-amino-9-[(2S,3S,4S,5R)-3-azido-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | [N-]=[N+]=N[C@@H]1[C@H](F)[C@@H](CO)O[C@@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C10H11FN8O3/c11-4-3(1-20)22-9(5(4)17-18-13)19-2-14-6-7(19)15-10(12)16-8(6)21/h2-5,9,20H,1H2,(H3,12,15,16,21)/t3-,4-,5-,9+/m1/s1 |
| InChIKey | UJCZMPKAYHLWDC-NFIRARSSSA-N |
| XLogP | -0.39 |
| TPSA | 167.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|