C11H14N8O4 — CID 136928993
2-amino-9-[(2R,3R,4S,5S)-4-(azidomethyl)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 136928993) has the molecular formula C11H14N8O4 and a molecular weight of 322.29 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5S)-4-(azidomethyl)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5S)-4-(azidomethyl)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136928993 |
| Molecular Formula | C11H14N8O4 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5S)-4-(azidomethyl)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | [N-]=[N+]=NC[C@H]1[C@@H](O)[C@H](n2cnc3c(=O)[nH]c(N)nc32)O[C@@H]1CO |
| InChI | InChI=1S/C11H14N8O4/c12-11-16-8-6(9(22)17-11)14-3-19(8)10-7(21)4(1-15-18-13)5(2-20)23-10/h3-5,7,10,20-21H,1-2H2,(H3,12,16,17,22)/t4-,5-,7-,10-/m1/s1 |
| InChIKey | QFESSFZUUIXGID-QYYRPYCUSA-N |
| XLogP | -1.12 |
| TPSA | 188.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|