C12H16N6O5 — CID 170315037
N-[[(2S,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]methyl]formamide (PubChem CID 170315037) has the molecular formula C12H16N6O5 and a molecular weight of 324.30 g/mol. Its IUPAC name is N-[[(2S,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]methyl]formamide.
| Compound Name | N-[[(2S,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]methyl]formamide |
|---|---|
| PubChem CID | 170315037 |
| Molecular Formula | C12H16N6O5 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-[[(2S,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]methyl]formamide |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](CO)[C@@H](CNC=O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C12H16N6O5/c13-12-16-9-7(10(22)17-12)15-3-18(9)11-8(21)5(1-14-4-20)6(2-19)23-11/h3-6,8,11,19,21H,1-2H2,(H,14,20)(H3,13,16,17,22)/t5-,6-,8-,11-/m1/s1 |
| InChIKey | PMFBWZKOSXUNEW-HUKYDQBMSA-N |
| XLogP | -2.69 |
| TPSA | 168.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|