C14H22N2O10P2 — CID 126639477
[[4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl]oxy-methylphosphinic acid (PubChem CID 126639477) has the molecular formula C14H22N2O10P2 and a molecular weight of 440.28 g/mol. Its IUPAC name is [[4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl]oxy-methylphosphinic acid.
| Compound Name | [[4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl]oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 126639477 |
| Molecular Formula | C14H22N2O10P2 |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | [[4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl]oxy-methylphosphinic acid |
| SMILES | CC1(C)OC2C(COP(=O)(O)OP(C)(=O)O)CC(n3ccc(=O)[nH]c3=O)C2O1 |
| InChI | InChI=1S/C14H22N2O10P2/c1-14(2)24-11-8(7-23-28(21,22)26-27(3,19)20)6-9(12(11)25-14)16-5-4-10(17)15-13(16)18/h4-5,8-9,11-12H,6-7H2,1-3H3,(H,19,20)(H,21,22)(H,15,17,18) |
| InChIKey | AAOQZZMBJHOCBB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 166.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|