C10H17N2O14P3S — CID 130406070
[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 130406070) has the molecular formula C10H17N2O14P3S and a molecular weight of 514.24 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 130406070 |
| Molecular Formula | C10H17N2O14P3S |
| Molecular Weight | 514.24 g/mol |
| Exact Mass | 513.96 |
| IUPAC Name | [[(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=S)[nH]c1=O |
| InChI | InChI=1S/C10H17N2O14P3S/c1-4-2-12(10(30)11-8(4)15)9-7(14)6(13)5(24-9)3-23-28(19,20)26-29(21,22)25-27(16,17)18/h2,5-7,9,13-14H,3H2,1H3,(H,19,20)(H,21,22)(H,11,15,30)(H2,16,17,18)/t5-,6-,7-,9-/m1/s1 |
| InChIKey | LAIWQWFCQYWQDP-JXOAFFINSA-N |
| XLogP | -0.82 |
| TPSA | 247.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.24 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|