C9H13F2N2O12P3S — CID 122449661
[[(2S,5R)-4-fluoro-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 122449661) has the molecular formula C9H13F2N2O12P3S and a molecular weight of 504.19 g/mol. Its IUPAC name is [[(2S,5R)-4-fluoro-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,5R)-4-fluoro-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122449661 |
| Molecular Formula | C9H13F2N2O12P3S |
| Molecular Weight | 504.19 g/mol |
| Exact Mass | 503.94 |
| IUPAC Name | [[(2S,5R)-4-fluoro-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=c1[nH]c(=S)n([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)CC2F)cc1F |
| InChI | InChI=1S/C9H13F2N2O12P3S/c10-5-1-4(23-8(5)13-2-6(11)7(14)12-9(13)29)3-22-27(18,19)25-28(20,21)24-26(15,16)17/h2,4-5,8H,1,3H2,(H,18,19)(H,20,21)(H,12,14,29)(H2,15,16,17)/t4-,5?,8+/m0/s1 |
| InChIKey | YRKORDXXDMQVQO-MOEMKQORSA-N |
| XLogP | 1.01 |
| TPSA | 206.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|