C9H14FN2O11P3S2 — CID 123882500
[[5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 123882500) has the molecular formula C9H14FN2O11P3S2 and a molecular weight of 502.27 g/mol. Its IUPAC name is [[5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 123882500 |
| Molecular Formula | C9H14FN2O11P3S2 |
| Molecular Weight | 502.27 g/mol |
| Exact Mass | 501.92 |
| IUPAC Name | [[5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-4-fluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OCC1CC(F)C(n2ccc(=S)[nH]c2=S)O1 |
| InChI | InChI=1S/C9H14FN2O11P3S2/c10-6-3-5(21-8(6)12-2-1-7(27)11-9(12)28)4-20-25(16,17)23-26(18,19)22-24(13,14)15/h1-2,5-6,8H,3-4H2,(H,16,17)(H,18,19)(H,11,27,28)(H2,13,14,15) |
| InChIKey | OMHNHSZMNAWUJT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 189.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|