C10H15F2N2O12P3S — CID 168886330
[[(2S,3S,5R)-2,3-difluoro-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 168886330) has the molecular formula C10H15F2N2O12P3S and a molecular weight of 518.22 g/mol. Its IUPAC name is [[(2S,3S,5R)-2,3-difluoro-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3S,5R)-2,3-difluoro-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 168886330 |
| Molecular Formula | C10H15F2N2O12P3S |
| Molecular Weight | 518.22 g/mol |
| Exact Mass | 517.95 |
| IUPAC Name | [[(2S,3S,5R)-2,3-difluoro-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1cn([C@H]2C[C@H](F)[C@@](F)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=S)[nH]c1=O |
| InChI | InChI=1S/C10H15F2N2O12P3S/c1-5-3-14(9(30)13-8(5)15)7-2-6(11)10(12,24-7)4-23-28(19,20)26-29(21,22)25-27(16,17)18/h3,6-7H,2,4H2,1H3,(H,19,20)(H,21,22)(H,13,15,30)(H2,16,17,18)/t6-,7+,10+/m0/s1 |
| InChIKey | AEQGTWDMGLYUKI-NYNCVSEMSA-N |
| XLogP | 1.48 |
| TPSA | 206.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|