C9H12ClFN2O9P2S — CID 153341987
[(2R,5R)-5-(5-chloro-4-oxo-2-sulfanylidenepyrimidin-1-yl)-2-fluorooxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 153341987) has the molecular formula C9H12ClFN2O9P2S and a molecular weight of 440.67 g/mol. Its IUPAC name is [(2R,5R)-5-(5-chloro-4-oxo-2-sulfanylidenepyrimidin-1-yl)-2-fluorooxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,5R)-5-(5-chloro-4-oxo-2-sulfanylidenepyrimidin-1-yl)-2-fluorooxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 153341987 |
| Molecular Formula | C9H12ClFN2O9P2S |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 439.94 |
| IUPAC Name | [(2R,5R)-5-(5-chloro-4-oxo-2-sulfanylidenepyrimidin-1-yl)-2-fluorooxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | O=c1[nH]c(=S)n([C@H]2CC[C@@](F)(COP(=O)(O)OP(=O)(O)O)O2)cc1Cl |
| InChI | InChI=1S/C9H12ClFN2O9P2S/c10-5-3-13(8(25)12-7(5)14)6-1-2-9(11,21-6)4-20-24(18,19)22-23(15,16)17/h3,6H,1-2,4H2,(H,18,19)(H,12,14,25)(H2,15,16,17)/t6-,9+/m1/s1 |
| InChIKey | RTBWVYGAELXKDY-MUWHJKNJSA-N |
| XLogP | 1.76 |
| TPSA | 160.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|