C10H13FN2O12P2S — CID 159323685
[dideuterio-[(2S,3S,4R,5R)-5-deuterio-2-fluoro-5-(5-formyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] phosphono hydrogen phosphate (PubChem CID 159323685) has the molecular formula C10H13FN2O12P2S and a molecular weight of 469.25 g/mol. Its IUPAC name is [dideuterio-[(2S,3S,4R,5R)-5-deuterio-2-fluoro-5-(5-formyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] phosphono hydrogen phosphate.
| Compound Name | [dideuterio-[(2S,3S,4R,5R)-5-deuterio-2-fluoro-5-(5-formyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 159323685 |
| Molecular Formula | C10H13FN2O12P2S |
| Molecular Weight | 469.25 g/mol |
| Exact Mass | 468.98 |
| IUPAC Name | [dideuterio-[(2S,3S,4R,5R)-5-deuterio-2-fluoro-5-(5-formyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] phosphono hydrogen phosphate |
| SMILES | [2H]C([2H])(OP(=O)(O)OP(=O)(O)O)[C@@]1(F)O[C@@]([2H])(n2cc(C=O)c(=O)[nH]c2=S)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H13FN2O12P2S/c11-10(3-23-27(21,22)25-26(18,19)20)6(16)5(15)8(24-10)13-1-4(2-14)7(17)12-9(13)28/h1-2,5-6,8,15-16H,3H2,(H,21,22)(H,12,17,28)(H2,18,19,20)/t5-,6+,8-,10-/m1/s1/i3D2,8D |
| InChIKey | KVVMTXXWQVGZEW-AONBSPJHSA-N |
| XLogP | -1.14 |
| TPSA | 217.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.25 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|