C9H12ClFN2O12P2 — CID 157405772
[(2S,3S,4R,5R)-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-5-deuterio-2-fluoro-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 157405772) has the molecular formula C9H12ClFN2O12P2 and a molecular weight of 457.60 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-5-deuterio-2-fluoro-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2S,3S,4R,5R)-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-5-deuterio-2-fluoro-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 157405772 |
| Molecular Formula | C9H12ClFN2O12P2 |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 456.96 |
| IUPAC Name | [(2S,3S,4R,5R)-5-(5-chloro-2,4-dioxopyrimidin-1-yl)-5-deuterio-2-fluoro-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | [2H][C@@]1(n2cc(Cl)c(=O)[nH]c2=O)O[C@](F)(COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H12ClFN2O12P2/c10-3-1-13(8(17)12-6(3)16)7-4(14)5(15)9(11,24-7)2-23-27(21,22)25-26(18,19)20/h1,4-5,7,14-15H,2H2,(H,21,22)(H,12,16,17)(H2,18,19,20)/t4-,5+,7-,9-/m1/s1/i7D |
| InChIKey | MNXVRILZYCXLMX-UMIJCJGSSA-N |
| XLogP | -1.67 |
| TPSA | 217.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|