C15H20FN3O8 — CID 157422702
[dideuterio-[(2S,3S,4R,5R)-5-deuterio-2-fluoro-5-(5-formyl-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] (2S)-2-amino-3-methylbutanoate (PubChem CID 157422702) has the molecular formula C15H20FN3O8 and a molecular weight of 392.35 g/mol. Its IUPAC name is [dideuterio-[(2S,3S,4R,5R)-5-deuterio-2-fluoro-5-(5-formyl-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [dideuterio-[(2S,3S,4R,5R)-5-deuterio-2-fluoro-5-(5-formyl-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 157422702 |
| Molecular Formula | C15H20FN3O8 |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [dideuterio-[(2S,3S,4R,5R)-5-deuterio-2-fluoro-5-(5-formyl-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] (2S)-2-amino-3-methylbutanoate |
| SMILES | [2H]C([2H])(OC(=O)[C@@H](N)C(C)C)[C@@]1(F)O[C@@]([2H])(n2cc(C=O)c(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H20FN3O8/c1-6(2)8(17)13(24)26-5-15(16)10(22)9(21)12(27-15)19-3-7(4-20)11(23)18-14(19)25/h3-4,6,8-10,12,21-22H,5,17H2,1-2H3,(H,18,23,25)/t8-,9+,10-,12+,15+/m0/s1/i5D2,12D |
| InChIKey | JHJJFJWILUQYDL-RBBODLSJSA-N |
| XLogP | -2.21 |
| TPSA | 173.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|