C15H21F2N3O5S — CID 159542300
[dideuterio-[(2S,3S,4R,5R)-5-deuterio-2-fluoro-5-(5-fluoro-2-methylidene-4-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] (2S)-2-amino-3-methylbutanoate (PubChem CID 159542300) has the molecular formula C15H21F2N3O5S and a molecular weight of 396.43 g/mol. Its IUPAC name is [dideuterio-[(2S,3S,4R,5R)-5-deuterio-2-fluoro-5-(5-fluoro-2-methylidene-4-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [dideuterio-[(2S,3S,4R,5R)-5-deuterio-2-fluoro-5-(5-fluoro-2-methylidene-4-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 159542300 |
| Molecular Formula | C15H21F2N3O5S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [dideuterio-[(2S,3S,4R,5R)-5-deuterio-2-fluoro-5-(5-fluoro-2-methylidene-4-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] (2S)-2-amino-3-methylbutanoate |
| SMILES | [2H]C([2H])(OC(=O)[C@@H](N)C(C)C)[C@@]1(F)O[C@@]([2H])(N2C=C(F)C(=S)NC2=C)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H21F2N3O5S/c1-6(2)9(18)14(23)24-5-15(17)11(22)10(21)13(25-15)20-4-8(16)12(26)19-7(20)3/h4,6,9-11,13,21-22H,3,5,18H2,1-2H3,(H,19,26)/t9-,10+,11-,13+,15+/m0/s1/i5D2,13D |
| InChIKey | ZSDNAELGTLTUKI-KUVYGEFESA-N |
| XLogP | -0.23 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|