C17H18FN2O8PS — CID 157170119
1-[(2R,3R,4S,5S)-2-deuterio-5-[dideuterio-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 157170119) has the molecular formula C17H18FN2O8PS and a molecular weight of 463.39 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-2-deuterio-5-[dideuterio-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-[(2R,3R,4S,5S)-2-deuterio-5-[dideuterio-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 157170119 |
| Molecular Formula | C17H18FN2O8PS |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-2-deuterio-5-[dideuterio-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | [2H]C([2H])(OP1(=O)OCc2cccc(C)c2O1)[C@@]1(F)O[C@@]([2H])(n2ccc(=O)[nH]c2=S)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H18FN2O8PS/c1-9-3-2-4-10-7-25-29(24,28-13(9)10)26-8-17(18)14(23)12(22)15(27-17)20-6-5-11(21)19-16(20)30/h2-6,12,14-15,22-23H,7-8H2,1H3,(H,19,21,30)/t12-,14+,15-,17-,29?/m1/s1/i8D2,15D |
| InChIKey | DUZUELGAEROLGR-OVSFUMBOSA-N |
| XLogP | 1.86 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|