C16H15ClFN2O8PS — CID 171581089
1-[(2R,3R,4S,5S)-5-[(6-chloro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy-dideuteriomethyl]-2-deuterio-5-fluoro-3,4-dihydroxyoxolan-2-yl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 171581089) has the molecular formula C16H15ClFN2O8PS and a molecular weight of 483.81 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-5-[(6-chloro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy-dideuteriomethyl]-2-deuterio-5-fluoro-3,4-dihydroxyoxolan-2-yl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-[(2R,3R,4S,5S)-5-[(6-chloro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy-dideuteriomethyl]-2-deuterio-5-fluoro-3,4-dihydroxyoxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 171581089 |
| Molecular Formula | C16H15ClFN2O8PS |
| Molecular Weight | 483.81 g/mol |
| Exact Mass | 483.01 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-5-[(6-chloro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy-dideuteriomethyl]-2-deuterio-5-fluoro-3,4-dihydroxyoxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | [2H]C([2H])(OP1(=O)OCc2cc(Cl)ccc2O1)[C@@]1(F)O[C@@]([2H])(n2ccc(=O)[nH]c2=S)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H15ClFN2O8PS/c17-9-1-2-10-8(5-9)6-25-29(24,28-10)26-7-16(18)13(23)12(22)14(27-16)20-4-3-11(21)19-15(20)30/h1-5,12-14,22-23H,6-7H2,(H,19,21,30)/t12-,13+,14-,16-,29?/m1/s1/i7D2,14D |
| InChIKey | LAAFLNOCNRDPAB-IPYWIVGXSA-N |
| XLogP | 2.21 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.81 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|