C16H14Cl2FN2O8PS — CID 159536565
5-chloro-1-[(2R,3R,4S,5S)-5-[(6-chloro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy-dideuteriomethyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 159536565) has the molecular formula C16H14Cl2FN2O8PS and a molecular weight of 517.25 g/mol. Its IUPAC name is 5-chloro-1-[(2R,3R,4S,5S)-5-[(6-chloro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy-dideuteriomethyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-chloro-1-[(2R,3R,4S,5S)-5-[(6-chloro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy-dideuteriomethyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 159536565 |
| Molecular Formula | C16H14Cl2FN2O8PS |
| Molecular Weight | 517.25 g/mol |
| Exact Mass | 515.97 |
| IUPAC Name | 5-chloro-1-[(2R,3R,4S,5S)-5-[(6-chloro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy-dideuteriomethyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | [2H]C([2H])(OP1(=O)OCc2cc(Cl)ccc2O1)[C@@]1(F)O[C@@H](n2cc(Cl)c(=O)[nH]c2=S)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H14Cl2FN2O8PS/c17-8-1-2-10-7(3-8)5-26-30(25,29-10)27-6-16(19)12(23)11(22)14(28-16)21-4-9(18)13(24)20-15(21)31/h1-4,11-12,14,22-23H,5-6H2,(H,20,24,31)/t11-,12+,14-,16-,30?/m1/s1/i6D2 |
| InChIKey | LWQQYSLWLIRRSL-GZUAMTJOSA-N |
| XLogP | 2.86 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|