C18H20FN2O8P — CID 162149966
1-[(2R,3R,5R)-2-deuterio-5-[dideuterio-[(6,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]-5-fluoro-3-hydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 162149966) has the molecular formula C18H20FN2O8P and a molecular weight of 445.35 g/mol. Its IUPAC name is 1-[(2R,3R,5R)-2-deuterio-5-[dideuterio-[(6,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]-5-fluoro-3-hydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,5R)-2-deuterio-5-[dideuterio-[(6,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]-5-fluoro-3-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 162149966 |
| Molecular Formula | C18H20FN2O8P |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 1-[(2R,3R,5R)-2-deuterio-5-[dideuterio-[(6,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]-5-fluoro-3-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [2H]C([2H])(OP1(=O)OCc2cc(C)cc(C)c2O1)[C@]1(F)C[C@@H](O)[C@]([2H])(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C18H20FN2O8P/c1-10-5-11(2)15-12(6-10)8-26-30(25,29-15)27-9-18(19)7-13(22)16(28-18)21-4-3-14(23)20-17(21)24/h3-6,13,16,22H,7-9H2,1-2H3,(H,20,23,24)/t13-,16-,18+,30?/m1/s1/i9D2,16D |
| InChIKey | YZSRKLNKAGBQKM-OVWUTTIESA-N |
| XLogP | 1.83 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|