C18H20FN2O9P — CID 172580702
1-[(2R,3R,4S,5S)-5-[(7,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 172580702) has the molecular formula C18H20FN2O9P and a molecular weight of 458.34 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-5-[(7,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5S)-5-[(7,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 172580702 |
| Molecular Formula | C18H20FN2O9P |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-5-[(7,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1ccc2c(c1C)OP(=O)(OC[C@@]1(F)O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](O)[C@@H]1O)OC2 |
| InChI | InChI=1S/C18H20FN2O9P/c1-9-3-4-11-7-27-31(26,30-14(11)10(9)2)28-8-18(19)15(24)13(23)16(29-18)21-6-5-12(22)20-17(21)25/h3-6,13,15-16,23-24H,7-8H2,1-2H3,(H,20,22,25)/t13-,15+,16-,18-,31?/m1/s1 |
| InChIKey | XIXVBUPQJGBBDI-ZUBFBRAPSA-N |
| XLogP | 0.80 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|