C18H19ClFN2O9P — CID 153342042
5-chloro-1-[(2R,3R,4S,5S)-5-[(6,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 153342042) has the molecular formula C18H19ClFN2O9P and a molecular weight of 492.78 g/mol. Its IUPAC name is 5-chloro-1-[(2R,3R,4S,5S)-5-[(6,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-chloro-1-[(2R,3R,4S,5S)-5-[(6,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 153342042 |
| Molecular Formula | C18H19ClFN2O9P |
| Molecular Weight | 492.78 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | 5-chloro-1-[(2R,3R,4S,5S)-5-[(6,8-dimethyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]-5-fluoro-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cc(C)c2c(c1)COP(=O)(OC[C@@]1(F)O[C@@H](n3cc(Cl)c(=O)[nH]c3=O)[C@H](O)[C@@H]1O)O2 |
| InChI | InChI=1S/C18H19ClFN2O9P/c1-8-3-9(2)13-10(4-8)6-28-32(27,31-13)29-7-18(20)14(24)12(23)16(30-18)22-5-11(19)15(25)21-17(22)26/h3-5,12,14,16,23-24H,6-7H2,1-2H3,(H,21,25,26)/t12-,14+,16-,18-,32?/m1/s1 |
| InChIKey | YKDYFNLRMZASCD-PIYOCXGNSA-N |
| XLogP | 1.46 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.78 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|