C17H18FN2O8P — CID 157418427
1-[(2R,3R,5R)-5-fluoro-3-hydroxy-5-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 157418427) has the molecular formula C17H18FN2O8P and a molecular weight of 428.31 g/mol. Its IUPAC name is 1-[(2R,3R,5R)-5-fluoro-3-hydroxy-5-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,5R)-5-fluoro-3-hydroxy-5-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 157418427 |
| Molecular Formula | C17H18FN2O8P |
| Molecular Weight | 428.31 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 1-[(2R,3R,5R)-5-fluoro-3-hydroxy-5-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cccc2c1OP(=O)(OC[C@]1(F)C[C@@H](O)[C@H](n3ccc(=O)[nH]c3=O)O1)OC2 |
| InChI | InChI=1S/C17H18FN2O8P/c1-10-3-2-4-11-8-25-29(24,28-14(10)11)26-9-17(18)7-12(21)15(27-17)20-6-5-13(22)19-16(20)23/h2-6,12,15,21H,7-9H2,1H3,(H,19,22,23)/t12-,15-,17+,29?/m1/s1 |
| InChIKey | OAYDZHABPUEOGS-LNLNZVIFSA-N |
| XLogP | 1.52 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|