C18H19N2O6P — CID 102580959
1-[(1S)-3-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]cyclopent-3-en-1-yl]pyrimidine-2,4-dione (PubChem CID 102580959) has the molecular formula C18H19N2O6P and a molecular weight of 390.33 g/mol. Its IUPAC name is 1-[(1S)-3-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]cyclopent-3-en-1-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1S)-3-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]cyclopent-3-en-1-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102580959 |
| Molecular Formula | C18H19N2O6P |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 1-[(1S)-3-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]cyclopent-3-en-1-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cccc2c1OP(=O)(OCC1=CC[C@H](n3ccc(=O)[nH]c3=O)C1)OC2 |
| InChI | InChI=1S/C18H19N2O6P/c1-12-3-2-4-14-11-25-27(23,26-17(12)14)24-10-13-5-6-15(9-13)20-8-7-16(21)19-18(20)22/h2-5,7-8,15H,6,9-11H2,1H3,(H,19,21,22)/t15-,27?/m0/s1 |
| InChIKey | XMGPFWPTGCGVMT-JCHGGWTISA-N |
| XLogP | 2.84 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|